C14H18N2O3 — CID 139841291
ethyl 5-hydroxy-5-pyridin-3-yl-2-azabicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 139841291) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is ethyl 5-hydroxy-5-pyridin-3-yl-2-azabicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | ethyl 5-hydroxy-5-pyridin-3-yl-2-azabicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 139841291 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | ethyl 5-hydroxy-5-pyridin-3-yl-2-azabicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CCOC(=O)N1CC2CC1CC2(O)c1cccnc1 |
| InChI | InChI=1S/C14H18N2O3/c1-2-19-13(17)16-9-11-6-12(16)7-14(11,18)10-4-3-5-15-8-10/h3-5,8,11-12,18H,2,6-7,9H2,1H3 |
| InChIKey | JASZXTBGYBWWLS-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |