C17H23ClN2O3 — CID 162524219
tert-butyl 5-(6-chloro-3-pyridinyl)-5-hydroxy-2-azabicyclo[2.2.2]octane-2-carboxylate (PubChem CID 162524219) has the molecular formula C17H23ClN2O3 and a molecular weight of 338.84 g/mol. Its IUPAC name is tert-butyl 5-(6-chloro-3-pyridinyl)-5-hydroxy-2-azabicyclo[2.2.2]octane-2-carboxylate.
| Compound Name | tert-butyl 5-(6-chloro-3-pyridinyl)-5-hydroxy-2-azabicyclo[2.2.2]octane-2-carboxylate |
|---|---|
| PubChem CID | 162524219 |
| Molecular Formula | C17H23ClN2O3 |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | tert-butyl 5-(6-chloro-3-pyridinyl)-5-hydroxy-2-azabicyclo[2.2.2]octane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2CCC1CC2(O)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C17H23ClN2O3/c1-16(2,3)23-15(21)20-10-12-4-6-13(20)8-17(12,22)11-5-7-14(18)19-9-11/h5,7,9,12-13,22H,4,6,8,10H2,1-3H3 |
| InChIKey | JGQBYFZXRPYCFT-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|