C16H19ClN2O2 — CID 11808958
tert-butyl (1R,4S)-6-(6-chloro-3-pyridinyl)-2-azabicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 11808958) has the molecular formula C16H19ClN2O2 and a molecular weight of 306.79 g/mol. Its IUPAC name is tert-butyl (1R,4S)-6-(6-chloro-3-pyridinyl)-2-azabicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | tert-butyl (1R,4S)-6-(6-chloro-3-pyridinyl)-2-azabicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 11808958 |
| Molecular Formula | C16H19ClN2O2 |
| Molecular Weight | 306.79 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | tert-butyl (1R,4S)-6-(6-chloro-3-pyridinyl)-2-azabicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2C=C(c3ccc(Cl)nc3)[C@H]1C2 |
| InChI | InChI=1S/C16H19ClN2O2/c1-16(2,3)21-15(20)19-9-10-6-12(13(19)7-10)11-4-5-14(17)18-8-11/h4-6,8,10,13H,7,9H2,1-3H3/t10-,13-/m1/s1 |
| InChIKey | NEMHWFSETCBMDQ-ZWNOBZJWSA-N |
| XLogP | 3.76 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.79 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|