C16H19ClN2O3 — CID 11290241
tert-butyl (1R,2R,4S)-2-(6-chloro-3-pyridinyl)-3-oxo-7-azabicyclo[2.2.1]heptane-7-carboxylate (PubChem CID 11290241) has the molecular formula C16H19ClN2O3 and a molecular weight of 322.79 g/mol. Its IUPAC name is tert-butyl (1R,2R,4S)-2-(6-chloro-3-pyridinyl)-3-oxo-7-azabicyclo[2.2.1]heptane-7-carboxylate.
| Compound Name | tert-butyl (1R,2R,4S)-2-(6-chloro-3-pyridinyl)-3-oxo-7-azabicyclo[2.2.1]heptane-7-carboxylate |
|---|---|
| PubChem CID | 11290241 |
| Molecular Formula | C16H19ClN2O3 |
| Molecular Weight | 322.79 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | tert-butyl (1R,2R,4S)-2-(6-chloro-3-pyridinyl)-3-oxo-7-azabicyclo[2.2.1]heptane-7-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]2CC[C@H]1C(=O)[C@@H]2c1ccc(Cl)nc1 |
| InChI | InChI=1S/C16H19ClN2O3/c1-16(2,3)22-15(21)19-10-5-6-11(19)14(20)13(10)9-4-7-12(17)18-8-9/h4,7-8,10-11,13H,5-6H2,1-3H3/t10-,11+,13-/m1/s1 |
| InChIKey | BNJQIGRRDZHLBB-NTZNESFSSA-N |
| XLogP | 3.17 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.79 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|