C12H20INO2 — CID 166052552
tert-butyl (1S,4S,5R)-5-iodo-2-azabicyclo[2.2.2]octane-2-carboxylate (PubChem CID 166052552) has the molecular formula C12H20INO2 and a molecular weight of 337.20 g/mol. Its IUPAC name is tert-butyl (1S,4S,5R)-5-iodo-2-azabicyclo[2.2.2]octane-2-carboxylate.
| Compound Name | tert-butyl (1S,4S,5R)-5-iodo-2-azabicyclo[2.2.2]octane-2-carboxylate |
|---|---|
| PubChem CID | 166052552 |
| Molecular Formula | C12H20INO2 |
| Molecular Weight | 337.20 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | tert-butyl (1S,4S,5R)-5-iodo-2-azabicyclo[2.2.2]octane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2CC[C@H]1C[C@H]2I |
| InChI | InChI=1S/C12H20INO2/c1-12(2,3)16-11(15)14-7-8-4-5-9(14)6-10(8)13/h8-10H,4-7H2,1-3H3/t8-,9-,10+/m0/s1 |
| InChIKey | DZYQJPLNHORTBU-LPEHRKFASA-N |
| XLogP | 3.21 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.20 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|