C40H56O6 — CID 139845096
bis(5-methyl-2-propan-2-ylcyclohexyl) 3,3-bis(phenylmethoxy)cyclobutane-1,2-dicarboxylate (PubChem CID 139845096) has the molecular formula C40H56O6 and a molecular weight of 632.88 g/mol. Its IUPAC name is bis(5-methyl-2-propan-2-ylcyclohexyl) 3,3-bis(phenylmethoxy)cyclobutane-1,2-dicarboxylate.
| Compound Name | bis(5-methyl-2-propan-2-ylcyclohexyl) 3,3-bis(phenylmethoxy)cyclobutane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 139845096 |
| Molecular Formula | C40H56O6 |
| Molecular Weight | 632.88 g/mol |
| Exact Mass | 632.41 |
| IUPAC Name | bis(5-methyl-2-propan-2-ylcyclohexyl) 3,3-bis(phenylmethoxy)cyclobutane-1,2-dicarboxylate |
| SMILES | CC1CCC(C(C)C)C(OC(=O)C2CC(OCc3ccccc3)(OCc3ccccc3)C2C(=O)OC2CC(C)CCC2C(C)C)C1 |
| InChI | InChI=1S/C40H56O6/c1-26(2)32-19-17-28(5)21-35(32)45-38(41)34-23-40(43-24-30-13-9-7-10-14-30,44-25-31-15-11-8-12-16-31)37(34)39(42)46-36-22-29(6)18-20-33(36)27(3)4/h7-16,26-29,32-37H,17-25H2,1-6H3 |
| InChIKey | LCEZOQBXNGWMNY-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.88 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|