C24H28F2 — CID 139849076
2-(2,6-difluoro-4-pentylphenyl)-6-[(E)-prop-1-enyl]-1,2,3,4-tetrahydronaphthalene (PubChem CID 139849076) has the molecular formula C24H28F2 and a molecular weight of 354.48 g/mol. Its IUPAC name is 2-(2,6-difluoro-4-pentylphenyl)-6-[(E)-prop-1-enyl]-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 2-(2,6-difluoro-4-pentylphenyl)-6-[(E)-prop-1-enyl]-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 139849076 |
| Molecular Formula | C24H28F2 |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | 2-(2,6-difluoro-4-pentylphenyl)-6-[(E)-prop-1-enyl]-1,2,3,4-tetrahydronaphthalene |
| SMILES | C/C=C/c1ccc2c(c1)CCC(c1c(F)cc(CCCCC)cc1F)C2 |
| InChI | InChI=1S/C24H28F2/c1-3-5-6-8-18-14-22(25)24(23(26)15-18)21-12-11-19-13-17(7-4-2)9-10-20(19)16-21/h4,7,9-10,13-15,21H,3,5-6,8,11-12,16H2,1-2H3/b7-4+ |
| InChIKey | KJBLGVPZXQXAKM-QPJJXVBHSA-N |
| XLogP | 7.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|