C32H36F3N3O4S — CID 139851670
N-[2-[5-[3-[8-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]naphthalen-2-yl]oxypropoxyamino]-1-benzothiophen-3-yl]ethyl]pentanamide (PubChem CID 139851670) has the molecular formula C32H36F3N3O4S and a molecular weight of 615.72 g/mol. Its IUPAC name is N-[2-[5-[3-[8-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]naphthalen-2-yl]oxypropoxyamino]-1-benzothiophen-3-yl]ethyl]pentanamide.
| Compound Name | N-[2-[5-[3-[8-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]naphthalen-2-yl]oxypropoxyamino]-1-benzothiophen-3-yl]ethyl]pentanamide |
|---|---|
| PubChem CID | 139851670 |
| Molecular Formula | C32H36F3N3O4S |
| Molecular Weight | 615.72 g/mol |
| Exact Mass | 615.24 |
| IUPAC Name | N-[2-[5-[3-[8-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]naphthalen-2-yl]oxypropoxyamino]-1-benzothiophen-3-yl]ethyl]pentanamide |
| SMILES | CCCCC(=O)NCCc1csc2ccc(NOCCCOc3ccc4cccc(CCNC(=O)C(F)(F)F)c4c3)cc12 |
| InChI | InChI=1S/C32H36F3N3O4S/c1-2-3-8-30(39)36-15-14-24-21-43-29-12-10-25(19-28(24)29)38-42-18-5-17-41-26-11-9-22-6-4-7-23(27(22)20-26)13-16-37-31(40)32(33,34)35/h4,6-7,9-12,19-21,38H,2-3,5,8,13-18H2,1H3,(H,36,39)(H,37,40) |
| InChIKey | KQCCDVWFNVIVKK-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.72 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|