C24H24F2N2O7 — CID 139851821
ethyl 10-[2-[bis(4-fluorophenyl)methoxy]ethyl]-2,3-dioxo-1,4-dioxa-7,10-diazaspiro[4.5]decane-7-carboxylate (PubChem CID 139851821) has the molecular formula C24H24F2N2O7 and a molecular weight of 490.46 g/mol. Its IUPAC name is ethyl 10-[2-[bis(4-fluorophenyl)methoxy]ethyl]-2,3-dioxo-1,4-dioxa-7,10-diazaspiro[4.5]decane-7-carboxylate.
| Compound Name | ethyl 10-[2-[bis(4-fluorophenyl)methoxy]ethyl]-2,3-dioxo-1,4-dioxa-7,10-diazaspiro[4.5]decane-7-carboxylate |
|---|---|
| PubChem CID | 139851821 |
| Molecular Formula | C24H24F2N2O7 |
| Molecular Weight | 490.46 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | ethyl 10-[2-[bis(4-fluorophenyl)methoxy]ethyl]-2,3-dioxo-1,4-dioxa-7,10-diazaspiro[4.5]decane-7-carboxylate |
| SMILES | CCOC(=O)N1CCN(CCOC(c2ccc(F)cc2)c2ccc(F)cc2)C2(C1)OC(=O)C(=O)O2 |
| InChI | InChI=1S/C24H24F2N2O7/c1-2-32-23(31)27-11-12-28(24(15-27)34-21(29)22(30)35-24)13-14-33-20(16-3-7-18(25)8-4-16)17-5-9-19(26)10-6-17/h3-10,20H,2,11-15H2,1H3 |
| InChIKey | ICDPDMMBDKRCCU-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.46 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|