C20H27NO5 — CID 139859742
3-(2,6-dimethylphenyl)-4-hydroxy-1-(methoxymethoxy)-5-methyl-5-(oxolan-2-ylmethyl)pyrrol-2-one (PubChem CID 139859742) has the molecular formula C20H27NO5 and a molecular weight of 361.44 g/mol. Its IUPAC name is 3-(2,6-dimethylphenyl)-4-hydroxy-1-(methoxymethoxy)-5-methyl-5-(oxolan-2-ylmethyl)pyrrol-2-one.
| Compound Name | 3-(2,6-dimethylphenyl)-4-hydroxy-1-(methoxymethoxy)-5-methyl-5-(oxolan-2-ylmethyl)pyrrol-2-one |
|---|---|
| PubChem CID | 139859742 |
| Molecular Formula | C20H27NO5 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | 3-(2,6-dimethylphenyl)-4-hydroxy-1-(methoxymethoxy)-5-methyl-5-(oxolan-2-ylmethyl)pyrrol-2-one |
| SMILES | COCON1C(=O)C(c2c(C)cccc2C)=C(O)C1(C)CC1CCCO1 |
| InChI | InChI=1S/C20H27NO5/c1-13-7-5-8-14(2)16(13)17-18(22)20(3,11-15-9-6-10-25-15)21(19(17)23)26-12-24-4/h5,7-8,15,22H,6,9-12H2,1-4H3 |
| InChIKey | LIPCEOHGBYTACZ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|