C26H33F — CID 139860894
1-fluoro-6-[(E)-pent-3-enyl]-2-[4-[(E)-pent-1-enyl]cyclohexyl]naphthalene (PubChem CID 139860894) has the molecular formula C26H33F and a molecular weight of 364.55 g/mol. Its IUPAC name is 1-fluoro-6-[(E)-pent-3-enyl]-2-[4-[(E)-pent-1-enyl]cyclohexyl]naphthalene.
| Compound Name | 1-fluoro-6-[(E)-pent-3-enyl]-2-[4-[(E)-pent-1-enyl]cyclohexyl]naphthalene |
|---|---|
| PubChem CID | 139860894 |
| Molecular Formula | C26H33F |
| Molecular Weight | 364.55 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | 1-fluoro-6-[(E)-pent-3-enyl]-2-[4-[(E)-pent-1-enyl]cyclohexyl]naphthalene |
| SMILES | C/C=C/CCc1ccc2c(F)c(C3CCC(/C=C/CCC)CC3)ccc2c1 |
| InChI | InChI=1S/C26H33F/c1-3-5-7-9-20-11-14-22(15-12-20)24-18-16-23-19-21(10-8-6-4-2)13-17-25(23)26(24)27/h4,6-7,9,13,16-20,22H,3,5,8,10-12,14-15H2,1-2H3/b6-4+,9-7+ |
| InChIKey | PJNWJJFWUJPGGR-ADIUVMHLSA-N |
| XLogP | 8.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.55 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|