C31H41F — CID 139864185
6-but-3-enyl-1-fluoro-2-[4-[1-[4-[(E)-prop-1-enyl]cyclohexyl]ethyl]cyclohexyl]naphthalene (PubChem CID 139864185) has the molecular formula C31H41F and a molecular weight of 432.67 g/mol. Its IUPAC name is 6-but-3-enyl-1-fluoro-2-[4-[1-[4-[(E)-prop-1-enyl]cyclohexyl]ethyl]cyclohexyl]naphthalene.
| Compound Name | 6-but-3-enyl-1-fluoro-2-[4-[1-[4-[(E)-prop-1-enyl]cyclohexyl]ethyl]cyclohexyl]naphthalene |
|---|---|
| PubChem CID | 139864185 |
| Molecular Formula | C31H41F |
| Molecular Weight | 432.67 g/mol |
| Exact Mass | 432.32 |
| IUPAC Name | 6-but-3-enyl-1-fluoro-2-[4-[1-[4-[(E)-prop-1-enyl]cyclohexyl]ethyl]cyclohexyl]naphthalene |
| SMILES | C=CCCc1ccc2c(F)c(C3CCC(C(C)C4CCC(/C=C/C)CC4)CC3)ccc2c1 |
| InChI | InChI=1S/C31H41F/c1-4-6-8-24-11-19-30-28(21-24)18-20-29(31(30)32)27-16-14-26(15-17-27)22(3)25-12-9-23(7-5-2)10-13-25/h4-5,7,11,18-23,25-27H,1,6,8-10,12-17H2,2-3H3/b7-5+ |
| InChIKey | YLTTVGJQECPNBL-FNORWQNLSA-N |
| XLogP | 9.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.67 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|