C27H32F2O — CID 139862921
3-[4-(4-ethenylcyclohexyl)cyclohexyl]-1,2-difluoro-7-prop-2-enoxynaphthalene (PubChem CID 139862921) has the molecular formula C27H32F2O and a molecular weight of 410.55 g/mol. Its IUPAC name is 3-[4-(4-ethenylcyclohexyl)cyclohexyl]-1,2-difluoro-7-prop-2-enoxynaphthalene.
| Compound Name | 3-[4-(4-ethenylcyclohexyl)cyclohexyl]-1,2-difluoro-7-prop-2-enoxynaphthalene |
|---|---|
| PubChem CID | 139862921 |
| Molecular Formula | C27H32F2O |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | 3-[4-(4-ethenylcyclohexyl)cyclohexyl]-1,2-difluoro-7-prop-2-enoxynaphthalene |
| SMILES | C=CCOc1ccc2cc(C3CCC(C4CCC(C=C)CC4)CC3)c(F)c(F)c2c1 |
| InChI | InChI=1S/C27H32F2O/c1-3-15-30-23-14-13-22-16-24(26(28)27(29)25(22)17-23)21-11-9-20(10-12-21)19-7-5-18(4-2)6-8-19/h3-4,13-14,16-21H,1-2,5-12,15H2 |
| InChIKey | YEVXYTXOMFNOQQ-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|