C31H27N5O3 — CID 139864550
N-[(2Z)-2-amino-2-(phenylhydrazinylidene)ethyl]-N-[4-[(8-hydroxyquinolin-2-yl)methoxy]phenyl]benzamide (PubChem CID 139864550) has the molecular formula C31H27N5O3 and a molecular weight of 517.59 g/mol. Its IUPAC name is N-[(2Z)-2-amino-2-(phenylhydrazinylidene)ethyl]-N-[4-[(8-hydroxyquinolin-2-yl)methoxy]phenyl]benzamide.
| Compound Name | N-[(2Z)-2-amino-2-(phenylhydrazinylidene)ethyl]-N-[4-[(8-hydroxyquinolin-2-yl)methoxy]phenyl]benzamide |
|---|---|
| PubChem CID | 139864550 |
| Molecular Formula | C31H27N5O3 |
| Molecular Weight | 517.59 g/mol |
| Exact Mass | 517.21 |
| IUPAC Name | N-[(2Z)-2-amino-2-(phenylhydrazinylidene)ethyl]-N-[4-[(8-hydroxyquinolin-2-yl)methoxy]phenyl]benzamide |
| SMILES | N/C(CN(C(=O)c1ccccc1)c1ccc(OCc2ccc3cccc(O)c3n2)cc1)=N\Nc1ccccc1 |
| InChI | InChI=1S/C31H27N5O3/c32-29(35-34-24-11-5-2-6-12-24)20-36(31(38)23-8-3-1-4-9-23)26-16-18-27(19-17-26)39-21-25-15-14-22-10-7-13-28(37)30(22)33-25/h1-19,34,37H,20-21H2,(H2,32,35) |
| InChIKey | CMAKNMXROQUEHC-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 113.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.59 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|