C8H20N2O2 — CID 139878296
N-ethyl-N',N'-dihydroxyhexane-1,6-diamine (PubChem CID 139878296) has the molecular formula C8H20N2O2 and a molecular weight of 176.26 g/mol. Its IUPAC name is N-ethyl-N',N'-dihydroxyhexane-1,6-diamine.
| Compound Name | N-ethyl-N',N'-dihydroxyhexane-1,6-diamine |
|---|---|
| PubChem CID | 139878296 |
| Molecular Formula | C8H20N2O2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.15 |
| IUPAC Name | N-ethyl-N',N'-dihydroxyhexane-1,6-diamine |
| SMILES | CCNCCCCCCN(O)O |
| InChI | InChI=1S/C8H20N2O2/c1-2-9-7-5-3-4-6-8-10(11)12/h9,11-12H,2-8H2,1H3 |
| InChIKey | FEBFPIRFJPBSGG-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|