C5H14N2O2 — CID 87304503
N-ethyl-N',N'-dihydroxypropane-1,3-diamine (PubChem CID 87304503) has the molecular formula C5H14N2O2 and a molecular weight of 134.18 g/mol. Its IUPAC name is N-ethyl-N',N'-dihydroxypropane-1,3-diamine.
| Compound Name | N-ethyl-N',N'-dihydroxypropane-1,3-diamine |
|---|---|
| PubChem CID | 87304503 |
| Molecular Formula | C5H14N2O2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.11 |
| IUPAC Name | N-ethyl-N',N'-dihydroxypropane-1,3-diamine |
| SMILES | CCNCCCN(O)O |
| InChI | InChI=1S/C5H14N2O2/c1-2-6-4-3-5-7(8)9/h6,8-9H,2-5H2,1H3 |
| InChIKey | ITTGTYIPBWKGOL-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|