C30H50O8 — CID 139878399
2,3-bis(4-pentylcyclohexyl)butane-1,2,3,4-tetracarboxylic acid (PubChem CID 139878399) has the molecular formula C30H50O8 and a molecular weight of 538.72 g/mol. Its IUPAC name is 2,3-bis(4-pentylcyclohexyl)butane-1,2,3,4-tetracarboxylic acid.
| Compound Name | 2,3-bis(4-pentylcyclohexyl)butane-1,2,3,4-tetracarboxylic acid |
|---|---|
| PubChem CID | 139878399 |
| Molecular Formula | C30H50O8 |
| Molecular Weight | 538.72 g/mol |
| Exact Mass | 538.35 |
| IUPAC Name | 2,3-bis(4-pentylcyclohexyl)butane-1,2,3,4-tetracarboxylic acid |
| SMILES | CCCCCC1CCC(C(CC(=O)O)(C(=O)O)C(CC(=O)O)(C(=O)O)C2CCC(CCCCC)CC2)CC1 |
| InChI | InChI=1S/C30H50O8/c1-3-5-7-9-21-11-15-23(16-12-21)29(27(35)36,19-25(31)32)30(28(37)38,20-26(33)34)24-17-13-22(14-18-24)10-8-6-4-2/h21-24H,3-20H2,1-2H3,(H,31,32)(H,33,34)(H,35,36)(H,37,38) |
| InChIKey | RAHKSABFEIEXCW-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.72 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|