C16H12FIN4O2 — CID 139878965
4-fluoro-N-hydroxy-2-(4-iodoanilino)-5-pyrazol-1-ylbenzamide (PubChem CID 139878965) has the molecular formula C16H12FIN4O2 and a molecular weight of 438.20 g/mol. Its IUPAC name is 4-fluoro-N-hydroxy-2-(4-iodoanilino)-5-pyrazol-1-ylbenzamide.
| Compound Name | 4-fluoro-N-hydroxy-2-(4-iodoanilino)-5-pyrazol-1-ylbenzamide |
|---|---|
| PubChem CID | 139878965 |
| Molecular Formula | C16H12FIN4O2 |
| Molecular Weight | 438.20 g/mol |
| Exact Mass | 438.00 |
| IUPAC Name | 4-fluoro-N-hydroxy-2-(4-iodoanilino)-5-pyrazol-1-ylbenzamide |
| SMILES | O=C(NO)c1cc(-n2cccn2)c(F)cc1Nc1ccc(I)cc1 |
| InChI | InChI=1S/C16H12FIN4O2/c17-13-9-14(20-11-4-2-10(18)3-5-11)12(16(23)21-24)8-15(13)22-7-1-6-19-22/h1-9,20,24H,(H,21,23) |
| InChIKey | KMMLYCMDFVCAPZ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.20 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|