C19H18FIN4O2 — CID 139878822
5-(3,5-dimethylpyrazol-1-yl)-4-fluoro-N-hydroxy-2-(4-iodo-2-methylanilino)benzamide (PubChem CID 139878822) has the molecular formula C19H18FIN4O2 and a molecular weight of 480.28 g/mol. Its IUPAC name is 5-(3,5-dimethylpyrazol-1-yl)-4-fluoro-N-hydroxy-2-(4-iodo-2-methylanilino)benzamide.
| Compound Name | 5-(3,5-dimethylpyrazol-1-yl)-4-fluoro-N-hydroxy-2-(4-iodo-2-methylanilino)benzamide |
|---|---|
| PubChem CID | 139878822 |
| Molecular Formula | C19H18FIN4O2 |
| Molecular Weight | 480.28 g/mol |
| Exact Mass | 480.05 |
| IUPAC Name | 5-(3,5-dimethylpyrazol-1-yl)-4-fluoro-N-hydroxy-2-(4-iodo-2-methylanilino)benzamide |
| SMILES | Cc1cc(C)n(-c2cc(C(=O)NO)c(Nc3ccc(I)cc3C)cc2F)n1 |
| InChI | InChI=1S/C19H18FIN4O2/c1-10-6-13(21)4-5-16(10)22-17-9-15(20)18(8-14(17)19(26)24-27)25-12(3)7-11(2)23-25/h4-9,22,27H,1-3H3,(H,24,26) |
| InChIKey | VNVJSXNDPBFGLF-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.28 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|