C21H25N3O4 — CID 139879467
methyl (2R,4R)-4-(2-nitroanilino)-1-[(1S)-1-phenylethyl]piperidine-2-carboxylate (PubChem CID 139879467) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is methyl (2R,4R)-4-(2-nitroanilino)-1-[(1S)-1-phenylethyl]piperidine-2-carboxylate.
| Compound Name | methyl (2R,4R)-4-(2-nitroanilino)-1-[(1S)-1-phenylethyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 139879467 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | methyl (2R,4R)-4-(2-nitroanilino)-1-[(1S)-1-phenylethyl]piperidine-2-carboxylate |
| SMILES | COC(=O)[C@H]1C[C@H](Nc2ccccc2[N+](=O)[O-])CCN1[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C21H25N3O4/c1-15(16-8-4-3-5-9-16)23-13-12-17(14-20(23)21(25)28-2)22-18-10-6-7-11-19(18)24(26)27/h3-11,15,17,20,22H,12-14H2,1-2H3/t15-,17+,20+/m0/s1 |
| InChIKey | LHTPARIRIIIPQP-XAUMDUMWSA-N |
| XLogP | 3.77 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|