About CID 144564385
CID 144564385 (PubChem CID 144564385) has the molecular formula C13H18BN3O2
and a molecular weight of 259.12 g/mol.
Molecular Properties
| Compound Name | CID 144564385 |
| PubChem CID | 144564385 |
| Molecular Formula | C13H18BN3O2 |
| Molecular Weight | 259.12 g/mol |
| Exact Mass | 259.15 |
| IUPAC Name | — |
| SMILES | [B]C1CC(Nc2ccccc2[N+](=O)[O-])CCN1CC |
| InChI | InChI=1S/C13H18BN3O2/c1-2-16-8-7-10(9-13(16)14)15-11-5-3-4-6-12(11)17(18)19/h3-6,10,13,15H,2,7-9H2,1H3 |
| InChIKey | DOPOFXMOWMVNSZ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.12 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 144564385 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 144564385?
The IUPAC name of CID 144564385 (CID 144564385) is not available.
What is the SMILES notation for CID 144564385?
The canonical SMILES for CID 144564385 is [B]C1CC(Nc2ccccc2[N+](=O)[O-])CCN1CC.
What is the InChIKey of CID 144564385?
The InChIKey is DOPOFXMOWMVNSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18BN3O2/c1-2-16-8-7-10(9-13(16)14)15-11-5-3-4-6-12(11)17(18)19/h3-6,10,13,15H,2,7-9H2,1H3.
What are the key properties of CID 144564385?
CID 144564385 has a molecular weight of 259.12 g/mol, XLogP of 1.99, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 144564385 is sourced from PubChem (CID 144564385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).