C9H14F5NS — CID 139879509
(2S)-2-(4,4,5,5,5-pentafluoropentylsulfanyl)pyrrolidine (PubChem CID 139879509) has the molecular formula C9H14F5NS and a molecular weight of 263.27 g/mol. Its IUPAC name is (2S)-2-(4,4,5,5,5-pentafluoropentylsulfanyl)pyrrolidine.
| Compound Name | (2S)-2-(4,4,5,5,5-pentafluoropentylsulfanyl)pyrrolidine |
|---|---|
| PubChem CID | 139879509 |
| Molecular Formula | C9H14F5NS |
| Molecular Weight | 263.27 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | (2S)-2-(4,4,5,5,5-pentafluoropentylsulfanyl)pyrrolidine |
| SMILES | FC(F)(F)C(F)(F)CCCS[C@H]1CCCN1 |
| InChI | InChI=1S/C9H14F5NS/c10-8(11,9(12,13)14)4-2-6-16-7-3-1-5-15-7/h7,15H,1-6H2/t7-/m0/s1 |
| InChIKey | OTFZULTVKGULJL-ZETCQYMHSA-N |
| XLogP | 3.41 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.27 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|