C13H19ClO — CID 139881036
6-butan-2-yl-3-(chloromethyl)-2,4-dimethylphenol (PubChem CID 139881036) has the molecular formula C13H19ClO and a molecular weight of 226.75 g/mol. Its IUPAC name is 6-butan-2-yl-3-(chloromethyl)-2,4-dimethylphenol.
| Compound Name | 6-butan-2-yl-3-(chloromethyl)-2,4-dimethylphenol |
|---|---|
| PubChem CID | 139881036 |
| Molecular Formula | C13H19ClO |
| Molecular Weight | 226.75 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 6-butan-2-yl-3-(chloromethyl)-2,4-dimethylphenol |
| SMILES | CCC(C)c1cc(C)c(CCl)c(C)c1O |
| InChI | InChI=1S/C13H19ClO/c1-5-8(2)11-6-9(3)12(7-14)10(4)13(11)15/h6,8,15H,5,7H2,1-4H3 |
| InChIKey | QQBGUCXPILHDEO-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.75 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|