C22H29N3O — CID 86076898
2,4-di(butan-2-yl)-6-(5,6-dimethylbenzotriazol-2-yl)phenol (PubChem CID 86076898) has the molecular formula C22H29N3O and a molecular weight of 351.49 g/mol. Its IUPAC name is 2,4-di(butan-2-yl)-6-(5,6-dimethylbenzotriazol-2-yl)phenol.
| Compound Name | 2,4-di(butan-2-yl)-6-(5,6-dimethylbenzotriazol-2-yl)phenol |
|---|---|
| PubChem CID | 86076898 |
| Molecular Formula | C22H29N3O |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | 2,4-di(butan-2-yl)-6-(5,6-dimethylbenzotriazol-2-yl)phenol |
| SMILES | CCC(C)c1cc(C(C)CC)c(O)c(-n2nc3cc(C)c(C)cc3n2)c1 |
| InChI | InChI=1S/C22H29N3O/c1-7-13(3)17-11-18(14(4)8-2)22(26)21(12-17)25-23-19-9-15(5)16(6)10-20(19)24-25/h9-14,26H,7-8H2,1-6H3 |
| InChIKey | UBVWCMCVGAXPAV-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |