C17H20ClN5O2S — CID 139882646
7-[(4-hydroxy-4-phenylbutyl)amino]-N-methyl-[1,3]thiazolo[5,4-d]pyrimidine-2-carboxamide;hydrochloride (PubChem CID 139882646) has the molecular formula C17H20ClN5O2S and a molecular weight of 393.90 g/mol. Its IUPAC name is 7-[(4-hydroxy-4-phenylbutyl)amino]-N-methyl-[1,3]thiazolo[5,4-d]pyrimidine-2-carboxamide;hydrochloride.
| Compound Name | 7-[(4-hydroxy-4-phenylbutyl)amino]-N-methyl-[1,3]thiazolo[5,4-d]pyrimidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 139882646 |
| Molecular Formula | C17H20ClN5O2S |
| Molecular Weight | 393.90 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | 7-[(4-hydroxy-4-phenylbutyl)amino]-N-methyl-[1,3]thiazolo[5,4-d]pyrimidine-2-carboxamide;hydrochloride |
| SMILES | CNC(=O)c1nc2c(NCCCC(O)c3ccccc3)ncnc2s1.Cl |
| InChI | InChI=1S/C17H19N5O2S.ClH/c1-18-15(24)17-22-13-14(20-10-21-16(13)25-17)19-9-5-8-12(23)11-6-3-2-4-7-11;/h2-4,6-7,10,12,23H,5,8-9H2,1H3,(H,18,24)(H,19,20,21);1H |
| InChIKey | CAGCXHTYLILZNQ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 100.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.90 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|