About N-methyl-[1,3]thiazolo[5,4-d]pyrimidine-2-carboxamide
N-methyl-[1,3]thiazolo[5,4-d]pyrimidine-2-carboxamide (PubChem CID 144771453) has the molecular formula C7H6N4OS
and a molecular weight of 194.22 g/mol. Its IUPAC name is N-methyl-[1,3]thiazolo[5,4-d]pyrimidine-2-carboxamide.
Molecular Properties
| Compound Name | N-methyl-[1,3]thiazolo[5,4-d]pyrimidine-2-carboxamide |
| PubChem CID | 144771453 |
| Molecular Formula | C7H6N4OS |
| Molecular Weight | 194.22 g/mol |
| Exact Mass | 194.03 |
| IUPAC Name | N-methyl-[1,3]thiazolo[5,4-d]pyrimidine-2-carboxamide |
| SMILES | CNC(=O)c1nc2cncnc2s1 |
| InChI | InChI=1S/C7H6N4OS/c1-8-5(12)7-11-4-2-9-3-10-6(4)13-7/h2-3H,1H3,(H,8,12) |
| InChIKey | LGTICSOHYCBICE-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.22 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-methyl-[1,3]thiazolo[5,4-d]pyrimidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-[1,3]thiazolo[5,4-d]pyrimidine-2-carboxamide?
The IUPAC name of N-methyl-[1,3]thiazolo[5,4-d]pyrimidine-2-carboxamide (CID 144771453) is N-methyl-[1,3]thiazolo[5,4-d]pyrimidine-2-carboxamide.
What is the SMILES notation for N-methyl-[1,3]thiazolo[5,4-d]pyrimidine-2-carboxamide?
The canonical SMILES for N-methyl-[1,3]thiazolo[5,4-d]pyrimidine-2-carboxamide is CNC(=O)c1nc2cncnc2s1.
What is the InChIKey of N-methyl-[1,3]thiazolo[5,4-d]pyrimidine-2-carboxamide?
The InChIKey is LGTICSOHYCBICE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N4OS/c1-8-5(12)7-11-4-2-9-3-10-6(4)13-7/h2-3H,1H3,(H,8,12).
What are the key properties of N-methyl-[1,3]thiazolo[5,4-d]pyrimidine-2-carboxamide?
N-methyl-[1,3]thiazolo[5,4-d]pyrimidine-2-carboxamide has a molecular weight of 194.22 g/mol, XLogP of 0.45, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-[1,3]thiazolo[5,4-d]pyrimidine-2-carboxamide is sourced from PubChem (CID 144771453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).