C20H27FN6O2S — CID 145312366
N-[3-(dimethylamino)propyl]-[1,3]thiazolo[5,4-d]pyrimidine-2-carboxamide;4-fluoro-2-propan-2-yloxyaniline (PubChem CID 145312366) has the molecular formula C20H27FN6O2S and a molecular weight of 434.54 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-[1,3]thiazolo[5,4-d]pyrimidine-2-carboxamide;4-fluoro-2-propan-2-yloxyaniline.
| Compound Name | N-[3-(dimethylamino)propyl]-[1,3]thiazolo[5,4-d]pyrimidine-2-carboxamide;4-fluoro-2-propan-2-yloxyaniline |
|---|---|
| PubChem CID | 145312366 |
| Molecular Formula | C20H27FN6O2S |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-[1,3]thiazolo[5,4-d]pyrimidine-2-carboxamide;4-fluoro-2-propan-2-yloxyaniline |
| SMILES | CC(C)Oc1cc(F)ccc1N.CN(C)CCCNC(=O)c1nc2cncnc2s1 |
| InChI | InChI=1S/C11H15N5OS.C9H12FNO/c1-16(2)5-3-4-13-9(17)11-15-8-6-12-7-14-10(8)18-11;1-6(2)12-9-5-7(10)3-4-8(9)11/h6-7H,3-5H2,1-2H3,(H,13,17);3-6H,11H2,1-2H3 |
| InChIKey | AWWWZQNNLCIYOE-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 106.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|