C12H17N5OS2 — CID 135333930
N-[3-(dimethylamino)propyl]-7-methylsulfanyl-[1,3]thiazolo[5,4-d]pyrimidine-2-carboxamide (PubChem CID 135333930) has the molecular formula C12H17N5OS2 and a molecular weight of 311.44 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-7-methylsulfanyl-[1,3]thiazolo[5,4-d]pyrimidine-2-carboxamide.
| Compound Name | N-[3-(dimethylamino)propyl]-7-methylsulfanyl-[1,3]thiazolo[5,4-d]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 135333930 |
| Molecular Formula | C12H17N5OS2 |
| Molecular Weight | 311.44 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-7-methylsulfanyl-[1,3]thiazolo[5,4-d]pyrimidine-2-carboxamide |
| SMILES | CSc1ncnc2sc(C(=O)NCCCN(C)C)nc12 |
| InChI | InChI=1S/C12H17N5OS2/c1-17(2)6-4-5-13-9(18)12-16-8-10(19-3)14-7-15-11(8)20-12/h7H,4-6H2,1-3H3,(H,13,18) |
| InChIKey | HOIKVHKGYGNSDX-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.44 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|