C24H37FN6O3S — CID 145312311
(3S)-2-(2-amino-5-fluorophenoxy)heptan-3-ol;N-[3-(dimethylamino)propyl]-4-methanimidoyl-5-(methylideneamino)-1,3-thiazole-2-carboxamide (PubChem CID 145312311) has the molecular formula C24H37FN6O3S and a molecular weight of 508.66 g/mol. Its IUPAC name is (3S)-2-(2-amino-5-fluorophenoxy)heptan-3-ol;N-[3-(dimethylamino)propyl]-4-methanimidoyl-5-(methylideneamino)-1,3-thiazole-2-carboxamide.
| Compound Name | (3S)-2-(2-amino-5-fluorophenoxy)heptan-3-ol;N-[3-(dimethylamino)propyl]-4-methanimidoyl-5-(methylideneamino)-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 145312311 |
| Molecular Formula | C24H37FN6O3S |
| Molecular Weight | 508.66 g/mol |
| Exact Mass | 508.26 |
| IUPAC Name | (3S)-2-(2-amino-5-fluorophenoxy)heptan-3-ol;N-[3-(dimethylamino)propyl]-4-methanimidoyl-5-(methylideneamino)-1,3-thiazole-2-carboxamide |
| SMILES | CCCC[C@H](O)C(C)Oc1cc(F)ccc1N.[H]/N=C/c1nc(C(=O)NCCCN(C)C)sc1N=C |
| InChI | InChI=1S/C13H20FNO2.C11H17N5OS/c1-3-4-5-12(16)9(2)17-13-8-10(14)6-7-11(13)15;1-13-10-8(7-12)15-11(18-10)9(17)14-5-4-6-16(2)3/h6-9,12,16H,3-5,15H2,1-2H3;7,12H,1,4-6H2,2-3H3,(H,14,17)/b;12-7+/t9?,12-;/m0./s1 |
| InChIKey | FICJGTCZAOHCFL-XDQISYQOSA-N |
| XLogP | 3.88 |
| TPSA | 136.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.66 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|