C13H22N4 — CID 139882722
2-[5-(4,5-dihydro-1H-imidazol-2-yl)-2-ethylpent-3-enyl]-4,5-dihydro-1H-imidazole (PubChem CID 139882722) has the molecular formula C13H22N4 and a molecular weight of 234.35 g/mol. Its IUPAC name is 2-[5-(4,5-dihydro-1H-imidazol-2-yl)-2-ethylpent-3-enyl]-4,5-dihydro-1H-imidazole.
| Compound Name | 2-[5-(4,5-dihydro-1H-imidazol-2-yl)-2-ethylpent-3-enyl]-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 139882722 |
| Molecular Formula | C13H22N4 |
| Molecular Weight | 234.35 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | 2-[5-(4,5-dihydro-1H-imidazol-2-yl)-2-ethylpent-3-enyl]-4,5-dihydro-1H-imidazole |
| SMILES | CCC(C=CCC1=NCCN1)CC1=NCCN1 |
| InChI | InChI=1S/C13H22N4/c1-2-11(10-13-16-8-9-17-13)4-3-5-12-14-6-7-15-12/h3-4,11H,2,5-10H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | IBCJMHYVBFMOFN-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.35 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|