C20H23NO4 — CID 139884994
(E)-3-[4-[2-[[(1S,2R)-1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]amino]ethyl]phenyl]prop-2-enoic acid (PubChem CID 139884994) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is (E)-3-[4-[2-[[(1S,2R)-1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]amino]ethyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[2-[[(1S,2R)-1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]amino]ethyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 139884994 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | (E)-3-[4-[2-[[(1S,2R)-1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]amino]ethyl]phenyl]prop-2-enoic acid |
| SMILES | C[C@@H](NCCc1ccc(/C=C/C(=O)O)cc1)[C@@H](O)c1ccc(O)cc1 |
| InChI | InChI=1S/C20H23NO4/c1-14(20(25)17-7-9-18(22)10-8-17)21-13-12-16-4-2-15(3-5-16)6-11-19(23)24/h2-11,14,20-22,25H,12-13H2,1H3,(H,23,24)/b11-6+/t14-,20-/m1/s1 |
| InChIKey | JFYPPXMZUYOGET-SBDWRMNISA-N |
| XLogP | 2.74 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|