C14H25N3O3 — CID 139885058
tert-butyl N-[2-oxo-2-[[(3S)-1-prop-2-enylpyrrolidin-3-yl]amino]ethyl]carbamate (PubChem CID 139885058) has the molecular formula C14H25N3O3 and a molecular weight of 283.37 g/mol. Its IUPAC name is tert-butyl N-[2-oxo-2-[[(3S)-1-prop-2-enylpyrrolidin-3-yl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-oxo-2-[[(3S)-1-prop-2-enylpyrrolidin-3-yl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 139885058 |
| Molecular Formula | C14H25N3O3 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | tert-butyl N-[2-oxo-2-[[(3S)-1-prop-2-enylpyrrolidin-3-yl]amino]ethyl]carbamate |
| SMILES | C=CCN1CC[C@H](NC(=O)CNC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C14H25N3O3/c1-5-7-17-8-6-11(10-17)16-12(18)9-15-13(19)20-14(2,3)4/h5,11H,1,6-10H2,2-4H3,(H,15,19)(H,16,18)/t11-/m0/s1 |
| InChIKey | RKAYFETWCZWJJZ-NSHDSACASA-N |
| XLogP | 0.89 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|