C12H18F2N2O3 — CID 146504244
tert-butyl N-(4,4-difluoro-1-prop-2-enoylpyrrolidin-3-yl)carbamate (PubChem CID 146504244) has the molecular formula C12H18F2N2O3 and a molecular weight of 276.28 g/mol. Its IUPAC name is tert-butyl N-(4,4-difluoro-1-prop-2-enoylpyrrolidin-3-yl)carbamate.
| Compound Name | tert-butyl N-(4,4-difluoro-1-prop-2-enoylpyrrolidin-3-yl)carbamate |
|---|---|
| PubChem CID | 146504244 |
| Molecular Formula | C12H18F2N2O3 |
| Molecular Weight | 276.28 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | tert-butyl N-(4,4-difluoro-1-prop-2-enoylpyrrolidin-3-yl)carbamate |
| SMILES | C=CC(=O)N1CC(NC(=O)OC(C)(C)C)C(F)(F)C1 |
| InChI | InChI=1S/C12H18F2N2O3/c1-5-9(17)16-6-8(12(13,14)7-16)15-10(18)19-11(2,3)4/h5,8H,1,6-7H2,2-4H3,(H,15,18) |
| InChIKey | BGVHWUBNFNOWAN-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.28 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|