About chromium(2+);bis(2-methyl-1H-inden-1-ide)
chromium(2+);bis(2-methyl-1H-inden-1-ide) (PubChem CID 139887885) has the molecular formula C20H18Cr
and a molecular weight of 310.36 g/mol. Its IUPAC name is chromium(2+);bis(2-methyl-1H-inden-1-ide).
Molecular Properties
| Compound Name | chromium(2+);bis(2-methyl-1H-inden-1-ide) |
| PubChem CID | 139887885 |
| Molecular Formula | C20H18Cr |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | chromium(2+);bis(2-methyl-1H-inden-1-ide) |
| SMILES | Cc1cc2ccccc2[cH-]1.Cc1cc2ccccc2[cH-]1.[Cr+2] |
| InChI | InChI=1S/2C10H9.Cr/c2*1-8-6-9-4-2-3-5-10(9)7-8;/h2*2-7H,1H3;/q2*-1;+2 |
| InChIKey | PMRDTBNFAKMHNL-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze chromium(2+);bis(2-methyl-1H-inden-1-ide) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chromium(2+);bis(2-methyl-1H-inden-1-ide)?
The IUPAC name of chromium(2+);bis(2-methyl-1H-inden-1-ide) (CID 139887885) is chromium(2+);bis(2-methyl-1H-inden-1-ide).
What is the SMILES notation for chromium(2+);bis(2-methyl-1H-inden-1-ide)?
The canonical SMILES for chromium(2+);bis(2-methyl-1H-inden-1-ide) is Cc1cc2ccccc2[cH-]1.Cc1cc2ccccc2[cH-]1.[Cr+2].
What is the InChIKey of chromium(2+);bis(2-methyl-1H-inden-1-ide)?
The InChIKey is PMRDTBNFAKMHNL-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H9.Cr/c2*1-8-6-9-4-2-3-5-10(9)7-8;/h2*2-7H,1H3;/q2*-1;+2.
What are the key properties of chromium(2+);bis(2-methyl-1H-inden-1-ide)?
chromium(2+);bis(2-methyl-1H-inden-1-ide) has a molecular weight of 310.36 g/mol, XLogP of 5.73, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chromium(2+);bis(2-methyl-1H-inden-1-ide) is sourced from PubChem (CID 139887885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).