About 2-methyl-1H-inden-1-ide;praseodymium
2-methyl-1H-inden-1-ide;praseodymium (PubChem CID 150206996) has the molecular formula C10H9Pr-
and a molecular weight of 270.09 g/mol. Its IUPAC name is 2-methyl-1H-inden-1-ide;praseodymium.
Molecular Properties
| Compound Name | 2-methyl-1H-inden-1-ide;praseodymium |
| PubChem CID | 150206996 |
| Molecular Formula | C10H9Pr- |
| Molecular Weight | 270.09 g/mol |
| Exact Mass | 269.98 |
| IUPAC Name | 2-methyl-1H-inden-1-ide;praseodymium |
| SMILES | Cc1cc2ccccc2[cH-]1.[Pr] |
| InChI | InChI=1S/C10H9.Pr/c1-8-6-9-4-2-3-5-10(9)7-8;/h2-7H,1H3;/q-1; |
| InChIKey | FGNYLALBESYNQG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.09 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-1H-inden-1-ide;praseodymium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1H-inden-1-ide;praseodymium?
The IUPAC name of 2-methyl-1H-inden-1-ide;praseodymium (CID 150206996) is 2-methyl-1H-inden-1-ide;praseodymium.
What is the SMILES notation for 2-methyl-1H-inden-1-ide;praseodymium?
The canonical SMILES for 2-methyl-1H-inden-1-ide;praseodymium is Cc1cc2ccccc2[cH-]1.[Pr].
What is the InChIKey of 2-methyl-1H-inden-1-ide;praseodymium?
The InChIKey is FGNYLALBESYNQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9.Pr/c1-8-6-9-4-2-3-5-10(9)7-8;/h2-7H,1H3;/q-1;.
What are the key properties of 2-methyl-1H-inden-1-ide;praseodymium?
2-methyl-1H-inden-1-ide;praseodymium has a molecular weight of 270.09 g/mol, XLogP of 2.87, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1H-inden-1-ide;praseodymium is sourced from PubChem (CID 150206996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).