C21H25N3O5S — CID 139888497
N-hydroxy-2-[2-[4-(4-methoxyphenyl)phenyl]ethylsulfonyl]-6-methyl-4,5-dihydro-3H-pyridazine-3-carboxamide (PubChem CID 139888497) has the molecular formula C21H25N3O5S and a molecular weight of 431.51 g/mol. Its IUPAC name is N-hydroxy-2-[2-[4-(4-methoxyphenyl)phenyl]ethylsulfonyl]-6-methyl-4,5-dihydro-3H-pyridazine-3-carboxamide.
| Compound Name | N-hydroxy-2-[2-[4-(4-methoxyphenyl)phenyl]ethylsulfonyl]-6-methyl-4,5-dihydro-3H-pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 139888497 |
| Molecular Formula | C21H25N3O5S |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | N-hydroxy-2-[2-[4-(4-methoxyphenyl)phenyl]ethylsulfonyl]-6-methyl-4,5-dihydro-3H-pyridazine-3-carboxamide |
| SMILES | COc1ccc(-c2ccc(CCS(=O)(=O)N3N=C(C)CCC3C(=O)NO)cc2)cc1 |
| InChI | InChI=1S/C21H25N3O5S/c1-15-3-12-20(21(25)23-26)24(22-15)30(27,28)14-13-16-4-6-17(7-5-16)18-8-10-19(29-2)11-9-18/h4-11,20,26H,3,12-14H2,1-2H3,(H,23,25) |
| InChIKey | MXDAPGIMGCSGNI-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|