About 2-trimethylsilyloxyethyl but-3-enoate
2-trimethylsilyloxyethyl but-3-enoate (PubChem CID 139889160) has the molecular formula C9H18O3Si
and a molecular weight of 202.33 g/mol. Its IUPAC name is 2-trimethylsilyloxyethyl but-3-enoate.
Molecular Properties
| Compound Name | 2-trimethylsilyloxyethyl but-3-enoate |
| PubChem CID | 139889160 |
| Molecular Formula | C9H18O3Si |
| Molecular Weight | 202.33 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 2-trimethylsilyloxyethyl but-3-enoate |
| SMILES | C=CCC(=O)OCCO[Si](C)(C)C |
| InChI | InChI=1S/C9H18O3Si/c1-5-6-9(10)11-7-8-12-13(2,3)4/h5H,1,6-8H2,2-4H3 |
| InChIKey | AQBSWUVMWOBYJA-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.33 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-trimethylsilyloxyethyl but-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-trimethylsilyloxyethyl but-3-enoate?
The IUPAC name of 2-trimethylsilyloxyethyl but-3-enoate (CID 139889160) is 2-trimethylsilyloxyethyl but-3-enoate.
What is the SMILES notation for 2-trimethylsilyloxyethyl but-3-enoate?
The canonical SMILES for 2-trimethylsilyloxyethyl but-3-enoate is C=CCC(=O)OCCO[Si](C)(C)C.
What is the InChIKey of 2-trimethylsilyloxyethyl but-3-enoate?
The InChIKey is AQBSWUVMWOBYJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O3Si/c1-5-6-9(10)11-7-8-12-13(2,3)4/h5H,1,6-8H2,2-4H3.
What are the key properties of 2-trimethylsilyloxyethyl but-3-enoate?
2-trimethylsilyloxyethyl but-3-enoate has a molecular weight of 202.33 g/mol, XLogP of 1.96, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-trimethylsilyloxyethyl but-3-enoate is sourced from PubChem (CID 139889160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).