C6H5FN2OS — CID 139890376
(5-fluoroimidazo[2,1-b][1,3]thiazol-2-yl)methanol (PubChem CID 139890376) has the molecular formula C6H5FN2OS and a molecular weight of 172.18 g/mol. Its IUPAC name is (5-fluoroimidazo[2,1-b][1,3]thiazol-2-yl)methanol.
| Compound Name | (5-fluoroimidazo[2,1-b][1,3]thiazol-2-yl)methanol |
|---|---|
| PubChem CID | 139890376 |
| Molecular Formula | C6H5FN2OS |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.01 |
| IUPAC Name | (5-fluoroimidazo[2,1-b][1,3]thiazol-2-yl)methanol |
| SMILES | OCc1cn2c(F)cnc2s1 |
| InChI | InChI=1S/C6H5FN2OS/c7-5-1-8-6-9(5)2-4(3-10)11-6/h1-2,10H,3H2 |
| InChIKey | CPYGKIXUJLIHNU-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |