C19H17NO6 — CID 139890801
1-(3,4-dimethoxyphenyl)-6-methoxy-4-oxoquinoline-3-carboxylic acid (PubChem CID 139890801) has the molecular formula C19H17NO6 and a molecular weight of 355.35 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-6-methoxy-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-(3,4-dimethoxyphenyl)-6-methoxy-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 139890801 |
| Molecular Formula | C19H17NO6 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-6-methoxy-4-oxoquinoline-3-carboxylic acid |
| SMILES | COc1ccc2c(c1)c(=O)c(C(=O)O)cn2-c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C19H17NO6/c1-24-12-5-6-15-13(9-12)18(21)14(19(22)23)10-20(15)11-4-7-16(25-2)17(8-11)26-3/h4-10H,1-3H3,(H,22,23) |
| InChIKey | UOOOXYILRMFCGD-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |