C26H22ClNO6 — CID 151632750
1-[3-[[2-(chloromethyl)phenyl]methoxy]-5-methoxyphenyl]-7-methoxy-4-oxoquinoline-3-carboxylic acid (PubChem CID 151632750) has the molecular formula C26H22ClNO6 and a molecular weight of 479.92 g/mol. Its IUPAC name is 1-[3-[[2-(chloromethyl)phenyl]methoxy]-5-methoxyphenyl]-7-methoxy-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-[3-[[2-(chloromethyl)phenyl]methoxy]-5-methoxyphenyl]-7-methoxy-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 151632750 |
| Molecular Formula | C26H22ClNO6 |
| Molecular Weight | 479.92 g/mol |
| Exact Mass | 479.11 |
| IUPAC Name | 1-[3-[[2-(chloromethyl)phenyl]methoxy]-5-methoxyphenyl]-7-methoxy-4-oxoquinoline-3-carboxylic acid |
| SMILES | COc1cc(OCc2ccccc2CCl)cc(-n2cc(C(=O)O)c(=O)c3ccc(OC)cc32)c1 |
| InChI | InChI=1S/C26H22ClNO6/c1-32-19-7-8-22-24(12-19)28(14-23(25(22)29)26(30)31)18-9-20(33-2)11-21(10-18)34-15-17-6-4-3-5-16(17)13-27/h3-12,14H,13,15H2,1-2H3,(H,30,31) |
| InChIKey | QQVZJFJLPIAULE-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.92 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|