C25H21NO6 — CID 139963681
1-[3-(methoxymethoxy)phenyl]-4-oxo-7-phenylmethoxyquinoline-3-carboxylic acid (PubChem CID 139963681) has the molecular formula C25H21NO6 and a molecular weight of 431.44 g/mol. Its IUPAC name is 1-[3-(methoxymethoxy)phenyl]-4-oxo-7-phenylmethoxyquinoline-3-carboxylic acid.
| Compound Name | 1-[3-(methoxymethoxy)phenyl]-4-oxo-7-phenylmethoxyquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 139963681 |
| Molecular Formula | C25H21NO6 |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | 1-[3-(methoxymethoxy)phenyl]-4-oxo-7-phenylmethoxyquinoline-3-carboxylic acid |
| SMILES | COCOc1cccc(-n2cc(C(=O)O)c(=O)c3ccc(OCc4ccccc4)cc32)c1 |
| InChI | InChI=1S/C25H21NO6/c1-30-16-32-19-9-5-8-18(12-19)26-14-22(25(28)29)24(27)21-11-10-20(13-23(21)26)31-15-17-6-3-2-4-7-17/h2-14H,15-16H2,1H3,(H,28,29) |
| InChIKey | SCQLKRBTOSZEFQ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|