C20H18N2O7 — CID 139963956
1-[3-(dimethylcarbamoyloxy)-5-methoxyphenyl]-7-hydroxy-4-oxoquinoline-3-carboxylic acid (PubChem CID 139963956) has the molecular formula C20H18N2O7 and a molecular weight of 398.37 g/mol. Its IUPAC name is 1-[3-(dimethylcarbamoyloxy)-5-methoxyphenyl]-7-hydroxy-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-[3-(dimethylcarbamoyloxy)-5-methoxyphenyl]-7-hydroxy-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 139963956 |
| Molecular Formula | C20H18N2O7 |
| Molecular Weight | 398.37 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | 1-[3-(dimethylcarbamoyloxy)-5-methoxyphenyl]-7-hydroxy-4-oxoquinoline-3-carboxylic acid |
| SMILES | COc1cc(OC(=O)N(C)C)cc(-n2cc(C(=O)O)c(=O)c3ccc(O)cc32)c1 |
| InChI | InChI=1S/C20H18N2O7/c1-21(2)20(27)29-14-7-11(6-13(9-14)28-3)22-10-16(19(25)26)18(24)15-5-4-12(23)8-17(15)22/h4-10,23H,1-3H3,(H,25,26) |
| InChIKey | UYMSWEQUPUJVSB-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 118.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.37 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |