C33H35BrF2N2O4S — CID 139963809
7-(7-bromoheptylsulfanyl)-N-(3,5-difluorophenyl)-1-(3,5-dimethoxyphenyl)-N-ethyl-4-oxoquinoline-3-carboxamide (PubChem CID 139963809) has the molecular formula C33H35BrF2N2O4S and a molecular weight of 673.62 g/mol. Its IUPAC name is 7-(7-bromoheptylsulfanyl)-N-(3,5-difluorophenyl)-1-(3,5-dimethoxyphenyl)-N-ethyl-4-oxoquinoline-3-carboxamide.
| Compound Name | 7-(7-bromoheptylsulfanyl)-N-(3,5-difluorophenyl)-1-(3,5-dimethoxyphenyl)-N-ethyl-4-oxoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 139963809 |
| Molecular Formula | C33H35BrF2N2O4S |
| Molecular Weight | 673.62 g/mol |
| Exact Mass | 672.15 |
| IUPAC Name | 7-(7-bromoheptylsulfanyl)-N-(3,5-difluorophenyl)-1-(3,5-dimethoxyphenyl)-N-ethyl-4-oxoquinoline-3-carboxamide |
| SMILES | CCN(C(=O)c1cn(-c2cc(OC)cc(OC)c2)c2cc(SCCCCCCCBr)ccc2c1=O)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C33H35BrF2N2O4S/c1-4-37(24-15-22(35)14-23(36)16-24)33(40)30-21-38(25-17-26(41-2)19-27(18-25)42-3)31-20-28(10-11-29(31)32(30)39)43-13-9-7-5-6-8-12-34/h10-11,14-21H,4-9,12-13H2,1-3H3 |
| InChIKey | VQDYUNFUNAVGOX-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.62 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|