C42H53F2N4O5+ — CID 139963822
7-[7-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)heptoxy]-1-(3-butoxy-5-methoxyphenyl)-N-(3,5-difluorophenyl)-N-ethyl-4-oxoquinoline-3-carboxamide (PubChem CID 139963822) has the molecular formula C42H53F2N4O5+ and a molecular weight of 731.90 g/mol. Its IUPAC name is 7-[7-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)heptoxy]-1-(3-butoxy-5-methoxyphenyl)-N-(3,5-difluorophenyl)-N-ethyl-4-oxoquinoline-3-carboxamide.
| Compound Name | 7-[7-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)heptoxy]-1-(3-butoxy-5-methoxyphenyl)-N-(3,5-difluorophenyl)-N-ethyl-4-oxoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 139963822 |
| Molecular Formula | C42H53F2N4O5+ |
| Molecular Weight | 731.90 g/mol |
| Exact Mass | 731.40 |
| IUPAC Name | 7-[7-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)heptoxy]-1-(3-butoxy-5-methoxyphenyl)-N-(3,5-difluorophenyl)-N-ethyl-4-oxoquinoline-3-carboxamide |
| SMILES | CCCCOc1cc(OC)cc(-n2cc(C(=O)N(CC)c3cc(F)cc(F)c3)c(=O)c3ccc(OCCCCCCC[N+]45CCN(CC4)CC5)cc32)c1 |
| InChI | InChI=1S/C42H53F2N4O5/c1-4-6-21-53-37-27-34(26-36(28-37)51-3)47-30-39(42(50)46(5-2)33-24-31(43)23-32(44)25-33)41(49)38-13-12-35(29-40(38)47)52-22-11-9-7-8-10-17-48-18-14-45(15-19-48)16-20-48/h12-13,23-30H,4-11,14-22H2,1-3H3/q+1 |
| InChIKey | QOAQZQSNIKJCQL-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 73.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.90 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|