C37H43BrF2N2O5S — CID 139963901
7-[7-(1-bromothiolan-1-yl)heptoxy]-N-(3,5-difluorophenyl)-1-(3,5-dimethoxyphenyl)-N-ethyl-4-oxoquinoline-3-carboxamide (PubChem CID 139963901) has the molecular formula C37H43BrF2N2O5S and a molecular weight of 745.73 g/mol. Its IUPAC name is 7-[7-(1-bromothiolan-1-yl)heptoxy]-N-(3,5-difluorophenyl)-1-(3,5-dimethoxyphenyl)-N-ethyl-4-oxoquinoline-3-carboxamide.
| Compound Name | 7-[7-(1-bromothiolan-1-yl)heptoxy]-N-(3,5-difluorophenyl)-1-(3,5-dimethoxyphenyl)-N-ethyl-4-oxoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 139963901 |
| Molecular Formula | C37H43BrF2N2O5S |
| Molecular Weight | 745.73 g/mol |
| Exact Mass | 744.20 |
| IUPAC Name | 7-[7-(1-bromothiolan-1-yl)heptoxy]-N-(3,5-difluorophenyl)-1-(3,5-dimethoxyphenyl)-N-ethyl-4-oxoquinoline-3-carboxamide |
| SMILES | CCN(C(=O)c1cn(-c2cc(OC)cc(OC)c2)c2cc(OCCCCCCCS3(Br)CCCC3)ccc2c1=O)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C37H43BrF2N2O5S/c1-4-41(28-19-26(39)18-27(40)20-28)37(44)34-25-42(29-21-31(45-2)23-32(22-29)46-3)35-24-30(12-13-33(35)36(34)43)47-14-8-6-5-7-9-15-48(38)16-10-11-17-48/h12-13,18-25H,4-11,14-17H2,1-3H3 |
| InChIKey | VMCGUIRUFGFPDJ-UHFFFAOYSA-N |
| XLogP | 9.19 |
| TPSA | 70.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.73 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|