C39H48ClF2N3O5 — CID 10312613
N-(3,5-difluorophenyl)-1-(3,5-dimethoxyphenyl)-N-ethyl-7-[7-(1-methylpiperidin-1-ium-1-yl)heptoxy]-4-oxoquinoline-3-carboxamide chloride (PubChem CID 10312613) has the molecular formula C39H48ClF2N3O5 and a molecular weight of 712.28 g/mol. Its IUPAC name is N-(3,5-difluorophenyl)-1-(3,5-dimethoxyphenyl)-N-ethyl-7-[7-(1-methylpiperidin-1-ium-1-yl)heptoxy]-4-oxoquinoline-3-carboxamide chloride.
| Compound Name | N-(3,5-difluorophenyl)-1-(3,5-dimethoxyphenyl)-N-ethyl-7-[7-(1-methylpiperidin-1-ium-1-yl)heptoxy]-4-oxoquinoline-3-carboxamide chloride |
|---|---|
| PubChem CID | 10312613 |
| Molecular Formula | C39H48ClF2N3O5 |
| Molecular Weight | 712.28 g/mol |
| Exact Mass | 711.33 |
| IUPAC Name | N-(3,5-difluorophenyl)-1-(3,5-dimethoxyphenyl)-N-ethyl-7-[7-(1-methylpiperidin-1-ium-1-yl)heptoxy]-4-oxoquinoline-3-carboxamide chloride |
| SMILES | CCN(C(=O)c1cn(-c2cc(OC)cc(OC)c2)c2cc(OCCCCCCC[N+]3(C)CCCCC3)ccc2c1=O)c1cc(F)cc(F)c1.[Cl-] |
| InChI | InChI=1S/C39H48F2N3O5.ClH/c1-5-42(30-21-28(40)20-29(41)22-30)39(46)36-27-43(31-23-33(47-3)25-34(24-31)48-4)37-26-32(14-15-35(37)38(36)45)49-19-13-8-6-7-10-16-44(2)17-11-9-12-18-44;/h14-15,20-27H,5-13,16-19H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | UYYLKWKFPKWJNG-UHFFFAOYSA-M |
| XLogP | 4.92 |
| TPSA | 70.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.28 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|