C41H52F2N3O5+ — CID 139964199
N-(3,5-difluorophenyl)-N-ethyl-1-(3-methoxy-5-propoxyphenyl)-7-[7-(1-methylpiperidin-1-ium-1-yl)heptoxy]-4-oxoquinoline-3-carboxamide (PubChem CID 139964199) has the molecular formula C41H52F2N3O5+ and a molecular weight of 704.88 g/mol. Its IUPAC name is N-(3,5-difluorophenyl)-N-ethyl-1-(3-methoxy-5-propoxyphenyl)-7-[7-(1-methylpiperidin-1-ium-1-yl)heptoxy]-4-oxoquinoline-3-carboxamide.
| Compound Name | N-(3,5-difluorophenyl)-N-ethyl-1-(3-methoxy-5-propoxyphenyl)-7-[7-(1-methylpiperidin-1-ium-1-yl)heptoxy]-4-oxoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 139964199 |
| Molecular Formula | C41H52F2N3O5+ |
| Molecular Weight | 704.88 g/mol |
| Exact Mass | 704.39 |
| IUPAC Name | N-(3,5-difluorophenyl)-N-ethyl-1-(3-methoxy-5-propoxyphenyl)-7-[7-(1-methylpiperidin-1-ium-1-yl)heptoxy]-4-oxoquinoline-3-carboxamide |
| SMILES | CCCOc1cc(OC)cc(-n2cc(C(=O)N(CC)c3cc(F)cc(F)c3)c(=O)c3ccc(OCCCCCCC[N+]4(C)CCCCC4)cc32)c1 |
| InChI | InChI=1S/C41H52F2N3O5/c1-5-20-50-36-26-33(25-35(27-36)49-4)45-29-38(41(48)44(6-2)32-23-30(42)22-31(43)24-32)40(47)37-16-15-34(28-39(37)45)51-21-14-9-7-8-11-17-46(3)18-12-10-13-19-46/h15-16,22-29H,5-14,17-21H2,1-4H3/q+1 |
| InChIKey | NWKZCGCCNXFQPP-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 70.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.88 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|