C43H55F2N4O5+ — CID 139963947
7-[8-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)octoxy]-1-(3-butoxy-5-methoxyphenyl)-N-(3,5-difluorophenyl)-N-ethyl-4-oxoquinoline-3-carboxamide (PubChem CID 139963947) has the molecular formula C43H55F2N4O5+ and a molecular weight of 745.93 g/mol. Its IUPAC name is 7-[8-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)octoxy]-1-(3-butoxy-5-methoxyphenyl)-N-(3,5-difluorophenyl)-N-ethyl-4-oxoquinoline-3-carboxamide.
| Compound Name | 7-[8-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)octoxy]-1-(3-butoxy-5-methoxyphenyl)-N-(3,5-difluorophenyl)-N-ethyl-4-oxoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 139963947 |
| Molecular Formula | C43H55F2N4O5+ |
| Molecular Weight | 745.93 g/mol |
| Exact Mass | 745.41 |
| IUPAC Name | 7-[8-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)octoxy]-1-(3-butoxy-5-methoxyphenyl)-N-(3,5-difluorophenyl)-N-ethyl-4-oxoquinoline-3-carboxamide |
| SMILES | CCCCOc1cc(OC)cc(-n2cc(C(=O)N(CC)c3cc(F)cc(F)c3)c(=O)c3ccc(OCCCCCCCC[N+]45CCN(CC4)CC5)cc32)c1 |
| InChI | InChI=1S/C43H55F2N4O5/c1-4-6-22-54-38-28-35(27-37(29-38)52-3)48-31-40(43(51)47(5-2)34-25-32(44)24-33(45)26-34)42(50)39-14-13-36(30-41(39)48)53-23-12-10-8-7-9-11-18-49-19-15-46(16-20-49)17-21-49/h13-14,24-31H,4-12,15-23H2,1-3H3/q+1 |
| InChIKey | NGRCXYOJNDFGKM-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 73.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.93 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|