C40H48BrF2N3O5 — CID 139963883
7-[7-(1-azoniabicyclo[2.2.2]octan-1-yl)heptoxy]-N-(3,5-difluorophenyl)-1-(3,4-dimethoxyphenyl)-N-ethyl-4-oxoquinoline-3-carboxamide bromide (PubChem CID 139963883) has the molecular formula C40H48BrF2N3O5 and a molecular weight of 768.74 g/mol. Its IUPAC name is 7-[7-(1-azoniabicyclo[2.2.2]octan-1-yl)heptoxy]-N-(3,5-difluorophenyl)-1-(3,4-dimethoxyphenyl)-N-ethyl-4-oxoquinoline-3-carboxamide bromide.
| Compound Name | 7-[7-(1-azoniabicyclo[2.2.2]octan-1-yl)heptoxy]-N-(3,5-difluorophenyl)-1-(3,4-dimethoxyphenyl)-N-ethyl-4-oxoquinoline-3-carboxamide bromide |
|---|---|
| PubChem CID | 139963883 |
| Molecular Formula | C40H48BrF2N3O5 |
| Molecular Weight | 768.74 g/mol |
| Exact Mass | 767.27 |
| IUPAC Name | 7-[7-(1-azoniabicyclo[2.2.2]octan-1-yl)heptoxy]-N-(3,5-difluorophenyl)-1-(3,4-dimethoxyphenyl)-N-ethyl-4-oxoquinoline-3-carboxamide bromide |
| SMILES | CCN(C(=O)c1cn(-c2ccc(OC)c(OC)c2)c2cc(OCCCCCCC[N+]34CCC(CC3)CC4)ccc2c1=O)c1cc(F)cc(F)c1.[Br-] |
| InChI | InChI=1S/C40H48F2N3O5.BrH/c1-4-43(32-23-29(41)22-30(42)24-32)40(47)35-27-44(31-10-13-37(48-2)38(25-31)49-3)36-26-33(11-12-34(36)39(35)46)50-21-9-7-5-6-8-17-45-18-14-28(15-19-45)16-20-45;/h10-13,22-28H,4-9,14-21H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | XTGBJLVIJOKCGY-UHFFFAOYSA-M |
| XLogP | 4.92 |
| TPSA | 70.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.74 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|