C41H53BrF2N4O5 — CID 139963944
1-(3,5-diethoxyphenyl)-N-(3,5-difluorophenyl)-7-[7-(1,4-dimethylpiperazin-1-ium-1-yl)heptoxy]-N-ethyl-4-oxoquinoline-3-carboxamide bromide (PubChem CID 139963944) has the molecular formula C41H53BrF2N4O5 and a molecular weight of 799.80 g/mol. Its IUPAC name is 1-(3,5-diethoxyphenyl)-N-(3,5-difluorophenyl)-7-[7-(1,4-dimethylpiperazin-1-ium-1-yl)heptoxy]-N-ethyl-4-oxoquinoline-3-carboxamide bromide.
| Compound Name | 1-(3,5-diethoxyphenyl)-N-(3,5-difluorophenyl)-7-[7-(1,4-dimethylpiperazin-1-ium-1-yl)heptoxy]-N-ethyl-4-oxoquinoline-3-carboxamide bromide |
|---|---|
| PubChem CID | 139963944 |
| Molecular Formula | C41H53BrF2N4O5 |
| Molecular Weight | 799.80 g/mol |
| Exact Mass | 798.32 |
| IUPAC Name | 1-(3,5-diethoxyphenyl)-N-(3,5-difluorophenyl)-7-[7-(1,4-dimethylpiperazin-1-ium-1-yl)heptoxy]-N-ethyl-4-oxoquinoline-3-carboxamide bromide |
| SMILES | CCOc1cc(OCC)cc(-n2cc(C(=O)N(CC)c3cc(F)cc(F)c3)c(=O)c3ccc(OCCCCCCC[N+]4(C)CCN(C)CC4)cc32)c1.[Br-] |
| InChI | InChI=1S/C41H53F2N4O5.BrH/c1-6-45(32-23-30(42)22-31(43)24-32)41(49)38-29-46(33-25-35(50-7-2)27-36(26-33)51-8-3)39-28-34(14-15-37(39)40(38)48)52-21-13-11-9-10-12-18-47(5)19-16-44(4)17-20-47;/h14-15,22-29H,6-13,16-21H2,1-5H3;1H/q+1;/p-1 |
| InChIKey | QUKXULWOFBOCMK-UHFFFAOYSA-M |
| XLogP | 4.46 |
| TPSA | 73.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 53 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.80 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|